C34H56O5 — CID 118102603
methyl (2S)-2-[3-[(1aR,3aR,6S,7E,7aS,7bR)-3,3,6,7a-tetramethyl-2-oxo-7-(2-oxopropylidene)-3a,4,5,7b-tetrahydro-1aH-naphtho[1,2-b]oxiren-6-yl]-3-methylbutyl]-2,5,5-trimethyloctanoate (PubChem CID 118102603) has the molecular formula C34H56O5 and a molecular weight of 544.82 g/mol. Its IUPAC name is methyl (2S)-2-[3-[(1aR,3aR,6S,7E,7aS,7bR)-3,3,6,7a-tetramethyl-2-oxo-7-(2-oxopropylidene)-3a,4,5,7b-tetrahydro-1aH-naphtho[1,2-b]oxiren-6-yl]-3-methylbutyl]-2,5,5-trimethyloctanoate.
| Compound Name | methyl (2S)-2-[3-[(1aR,3aR,6S,7E,7aS,7bR)-3,3,6,7a-tetramethyl-2-oxo-7-(2-oxopropylidene)-3a,4,5,7b-tetrahydro-1aH-naphtho[1,2-b]oxiren-6-yl]-3-methylbutyl]-2,5,5-trimethyloctanoate |
|---|---|
| PubChem CID | 118102603 |
| Molecular Formula | C34H56O5 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | methyl (2S)-2-[3-[(1aR,3aR,6S,7E,7aS,7bR)-3,3,6,7a-tetramethyl-2-oxo-7-(2-oxopropylidene)-3a,4,5,7b-tetrahydro-1aH-naphtho[1,2-b]oxiren-6-yl]-3-methylbutyl]-2,5,5-trimethyloctanoate |
| SMILES | CCCC(C)(C)CC[C@@](C)(CCC(C)(C)[C@]1(C)CC[C@H]2C(C)(C)C(=O)[C@@H]3O[C@@H]3[C@]2(C)/C1=C/C(C)=O)C(=O)OC |
| InChI | InChI=1S/C34H56O5/c1-13-15-29(3,4)17-19-32(9,28(37)38-12)20-18-30(5,6)33(10)16-14-23-31(7,8)26(36)25-27(39-25)34(23,11)24(33)21-22(2)35/h21,23,25,27H,13-20H2,1-12H3/b24-21+/t23-,25-,27-,32-,33+,34-/m0/s1 |
| InChIKey | BSPFIBHTCPJOOQ-ZHFWHNNWSA-N |
| XLogP | 7.89 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|