C34H47F3N2O4 — CID 118102604
(1S,2R,5S,15S,16R,18R,21R)-18-cyano-1,2,5,8,8,15,20,20-octamethyl-12,19-dioxo-N-(2,2,2-trifluoroethyl)-17-oxapentacyclo[12.9.0.02,11.015,21.016,18]tricos-13-ene-5-carboxamide (PubChem CID 118102604) has the molecular formula C34H47F3N2O4 and a molecular weight of 604.75 g/mol. Its IUPAC name is (1S,2R,5S,15S,16R,18R,21R)-18-cyano-1,2,5,8,8,15,20,20-octamethyl-12,19-dioxo-N-(2,2,2-trifluoroethyl)-17-oxapentacyclo[12.9.0.02,11.015,21.016,18]tricos-13-ene-5-carboxamide.
| Compound Name | (1S,2R,5S,15S,16R,18R,21R)-18-cyano-1,2,5,8,8,15,20,20-octamethyl-12,19-dioxo-N-(2,2,2-trifluoroethyl)-17-oxapentacyclo[12.9.0.02,11.015,21.016,18]tricos-13-ene-5-carboxamide |
|---|---|
| PubChem CID | 118102604 |
| Molecular Formula | C34H47F3N2O4 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | (1S,2R,5S,15S,16R,18R,21R)-18-cyano-1,2,5,8,8,15,20,20-octamethyl-12,19-dioxo-N-(2,2,2-trifluoroethyl)-17-oxapentacyclo[12.9.0.02,11.015,21.016,18]tricos-13-ene-5-carboxamide |
| SMILES | CC1(C)CCC2C(=O)C=C3[C@@]4(C)[C@H]5O[C@@]5(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]2(C)CC[C@@](C)(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C34H47F3N2O4/c1-27(2)11-9-20-21(40)17-23-31(7,12-10-22-28(3,4)24(41)33(18-38)25(43-33)32(22,23)8)30(20,6)16-15-29(5,14-13-27)26(42)39-19-34(35,36)37/h17,20,22,25H,9-16,19H2,1-8H3,(H,39,42)/t20?,22-,25+,29-,30+,31+,32-,33-/m0/s1 |
| InChIKey | YXUBKHZZUJXGCX-VJKIIPRYSA-N |
| XLogP | 6.88 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|