C33H44F2N2O4 — CID 118102629
N-[(1S,2R,5S,10R,15S,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-en-5-yl]-2,2-difluoropropanamide (PubChem CID 118102629) has the molecular formula C33H44F2N2O4 and a molecular weight of 570.72 g/mol. Its IUPAC name is N-[(1S,2R,5S,10R,15S,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-en-5-yl]-2,2-difluoropropanamide.
| Compound Name | N-[(1S,2R,5S,10R,15S,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-en-5-yl]-2,2-difluoropropanamide |
|---|---|
| PubChem CID | 118102629 |
| Molecular Formula | C33H44F2N2O4 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | N-[(1S,2R,5S,10R,15S,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-en-5-yl]-2,2-difluoropropanamide |
| SMILES | CC1(C)CC[C@]2(NC(=O)C(C)(F)F)CC[C@]3(C)C(C(=O)C=C4[C@@]5(C)[C@H]6O[C@@]6(C#N)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]2C1 |
| InChI | InChI=1S/C33H44F2N2O4/c1-26(2)11-13-32(37-25(40)31(8,34)35)14-12-29(6)22(18(32)16-26)19(38)15-21-28(29,5)10-9-20-27(3,4)23(39)33(17-36)24(41-33)30(20,21)7/h15,18,20,22,24H,9-14,16H2,1-8H3,(H,37,40)/t18-,20+,22?,24-,28-,29-,30+,32+,33+/m1/s1 |
| InChIKey | VNOGOBIIVWKISU-OLNBCAFHSA-N |
| XLogP | 5.94 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|