C25H26Cl2F2N4O4S — CID 118102749
3-[(2S)-1-[[(4R)-4-(2,4-dichlorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-5,5-difluoropiperidin-2-yl]propanoic acid (PubChem CID 118102749) has the molecular formula C25H26Cl2F2N4O4S and a molecular weight of 587.48 g/mol. Its IUPAC name is 3-[(2S)-1-[[(4R)-4-(2,4-dichlorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-5,5-difluoropiperidin-2-yl]propanoic acid.
| Compound Name | 3-[(2S)-1-[[(4R)-4-(2,4-dichlorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-5,5-difluoropiperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 118102749 |
| Molecular Formula | C25H26Cl2F2N4O4S |
| Molecular Weight | 587.48 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 3-[(2S)-1-[[(4R)-4-(2,4-dichlorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]-5,5-difluoropiperidin-2-yl]propanoic acid |
| SMILES | CCOC(=O)C1=C(CN2CC(F)(F)CC[C@@H]2CCC(=O)O)NC(c2nccs2)=N[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H26Cl2F2N4O4S/c1-2-37-24(36)20-18(12-33-13-25(28,29)8-7-15(33)4-6-19(34)35)31-22(23-30-9-10-38-23)32-21(20)16-5-3-14(26)11-17(16)27/h3,5,9-11,15,21H,2,4,6-8,12-13H2,1H3,(H,31,32)(H,34,35)/t15-,21-/m0/s1 |
| InChIKey | AQDHUJQQEQSSDO-BTYIYWSLSA-N |
| XLogP | 5.32 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |