About 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid
3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid (PubChem CID 118102957) has the molecular formula C13H21F2NO4
and a molecular weight of 293.31 g/mol. Its IUPAC name is 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid.
Molecular Properties
| Compound Name | 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid |
| PubChem CID | 118102957 |
| Molecular Formula | C13H21F2NO4 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid |
| SMILES | CC(CC(=O)O)[C@@H]1CC(F)(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21F2NO4/c1-8(5-10(17)18)9-6-13(14,15)7-16(9)11(19)20-12(2,3)4/h8-9H,5-7H2,1-4H3,(H,17,18)/t8?,9-/m0/s1 |
| InChIKey | CIRKUNOINRFOTG-GKAPJAKFSA-N |
| XLogP | 2.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid?
The IUPAC name of 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid (CID 118102957) is 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid.
What is the SMILES notation for 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid?
The canonical SMILES for 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid is CC(CC(=O)O)[C@@H]1CC(F)(F)CN1C(=O)OC(C)(C)C.
What is the InChIKey of 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid?
The InChIKey is CIRKUNOINRFOTG-GKAPJAKFSA-N. The full InChI is InChI=1S/C13H21F2NO4/c1-8(5-10(17)18)9-6-13(14,15)7-16(9)11(19)20-12(2,3)4/h8-9H,5-7H2,1-4H3,(H,17,18)/t8?,9-/m0/s1.
What are the key properties of 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid?
3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid has a molecular weight of 293.31 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]butanoic acid is sourced from PubChem (CID 118102957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).