C36H36O7 — CID 118103021
methyl 4-[4-hexoxy-3,5-bis(4-methoxycarbonylphenyl)phenyl]benzoate (PubChem CID 118103021) has the molecular formula C36H36O7 and a molecular weight of 580.68 g/mol. Its IUPAC name is methyl 4-[4-hexoxy-3,5-bis(4-methoxycarbonylphenyl)phenyl]benzoate.
| Compound Name | methyl 4-[4-hexoxy-3,5-bis(4-methoxycarbonylphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 118103021 |
| Molecular Formula | C36H36O7 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | methyl 4-[4-hexoxy-3,5-bis(4-methoxycarbonylphenyl)phenyl]benzoate |
| SMILES | CCCCCCOc1c(-c2ccc(C(=O)OC)cc2)cc(-c2ccc(C(=O)OC)cc2)cc1-c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C36H36O7/c1-5-6-7-8-21-43-33-31(25-11-17-28(18-12-25)35(38)41-3)22-30(24-9-15-27(16-10-24)34(37)40-2)23-32(33)26-13-19-29(20-14-26)36(39)42-4/h9-20,22-23H,5-8,21H2,1-4H3 |
| InChIKey | BUNLBSCHYPZBQV-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|