C17H24N2O2S2 — CID 11810326
13,16-dimethyl-2,6-dioxa-10,19-dithia-13,16-diazatricyclo[16.3.0.07,11]henicosa-1(18),7(11),8,20-tetraene (PubChem CID 11810326) has the molecular formula C17H24N2O2S2 and a molecular weight of 352.53 g/mol. Its IUPAC name is 13,16-dimethyl-2,6-dioxa-10,19-dithia-13,16-diazatricyclo[16.3.0.07,11]henicosa-1(18),7(11),8,20-tetraene.
| Compound Name | 13,16-dimethyl-2,6-dioxa-10,19-dithia-13,16-diazatricyclo[16.3.0.07,11]henicosa-1(18),7(11),8,20-tetraene |
|---|---|
| PubChem CID | 11810326 |
| Molecular Formula | C17H24N2O2S2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 13,16-dimethyl-2,6-dioxa-10,19-dithia-13,16-diazatricyclo[16.3.0.07,11]henicosa-1(18),7(11),8,20-tetraene |
| SMILES | CN1CCN(C)Cc2sccc2OCCCOc2ccsc2C1 |
| InChI | InChI=1S/C17H24N2O2S2/c1-18-6-7-19(2)13-17-15(5-11-23-17)21-9-3-8-20-14-4-10-22-16(14)12-18/h4-5,10-11H,3,6-9,12-13H2,1-2H3 |
| InChIKey | CUXYEJOCSAQKIW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |