C11H19F3N2 — CID 118103383
1-methyl-4-(2,2,2-trifluoroethyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 118103383) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 1-methyl-4-(2,2,2-trifluoroethyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | 1-methyl-4-(2,2,2-trifluoroethyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 118103383 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-methyl-4-(2,2,2-trifluoroethyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | CN1CCN(CC(F)(F)F)C2CCCCC21 |
| InChI | InChI=1S/C11H19F3N2/c1-15-6-7-16(8-11(12,13)14)10-5-3-2-4-9(10)15/h9-10H,2-8H2,1H3 |
| InChIKey | XAVBDSFRUDEJSF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |