C20H17FN2O2 — CID 118103552
8-[(4-fluorophenyl)methyl]-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one (PubChem CID 118103552) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is 8-[(4-fluorophenyl)methyl]-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one.
| Compound Name | 8-[(4-fluorophenyl)methyl]-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one |
|---|---|
| PubChem CID | 118103552 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 8-[(4-fluorophenyl)methyl]-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one |
| SMILES | O=C1OCC2Cc3c(n(Cc4ccc(F)cc4)c4ccccc34)CN12 |
| InChI | InChI=1S/C20H17FN2O2/c21-14-7-5-13(6-8-14)10-23-18-4-2-1-3-16(18)17-9-15-12-25-20(24)22(15)11-19(17)23/h1-8,15H,9-12H2 |
| InChIKey | QUCKSDQHANYGTD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|