C33H44Cl2N4O7 — CID 118103632
(2S,3S,4R,5S)-6-[4-[2,5-dichloro-4-[[[1-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)cyclopropyl]amino]methyl]phenyl]butyl-methylamino]-2,3,4,5-tetrahydroxyhexanoic acid (PubChem CID 118103632) has the molecular formula C33H44Cl2N4O7 and a molecular weight of 679.64 g/mol. Its IUPAC name is (2S,3S,4R,5S)-6-[4-[2,5-dichloro-4-[[[1-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)cyclopropyl]amino]methyl]phenyl]butyl-methylamino]-2,3,4,5-tetrahydroxyhexanoic acid.
| Compound Name | (2S,3S,4R,5S)-6-[4-[2,5-dichloro-4-[[[1-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)cyclopropyl]amino]methyl]phenyl]butyl-methylamino]-2,3,4,5-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 118103632 |
| Molecular Formula | C33H44Cl2N4O7 |
| Molecular Weight | 679.64 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | (2S,3S,4R,5S)-6-[4-[2,5-dichloro-4-[[[1-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)cyclopropyl]amino]methyl]phenyl]butyl-methylamino]-2,3,4,5-tetrahydroxyhexanoic acid |
| SMILES | CN(CCCCc1cc(Cl)c(CNC2(C(=O)N3CCN(C4CC4)c4ccccc43)CC2)cc1Cl)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C33H44Cl2N4O7/c1-37(19-27(40)28(41)29(42)30(43)31(44)45)13-5-4-6-20-16-24(35)21(17-23(20)34)18-36-33(11-12-33)32(46)39-15-14-38(22-9-10-22)25-7-2-3-8-26(25)39/h2-3,7-8,16-17,22,27-30,36,40-43H,4-6,9-15,18-19H2,1H3,(H,44,45)/t27-,28+,29-,30-/m0/s1 |
| InChIKey | LOTHNUKVAGULDG-XJYHXZFBSA-N |
| XLogP | 2.41 |
| TPSA | 157.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|