C19H20F3N5O4S — CID 118103832
N-(2-methylsulfonylethyl)-4-[(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-3-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 118103832) has the molecular formula C19H20F3N5O4S and a molecular weight of 471.46 g/mol. Its IUPAC name is N-(2-methylsulfonylethyl)-4-[(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-3-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(2-methylsulfonylethyl)-4-[(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-3-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 118103832 |
| Molecular Formula | C19H20F3N5O4S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-(2-methylsulfonylethyl)-4-[(6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-3-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | Cc1ccc2nc(Nc3ccc(C(=O)NCCS(C)(=O)=O)cc3OCC(F)(F)F)nn2c1 |
| InChI | InChI=1S/C19H20F3N5O4S/c1-12-3-6-16-25-18(26-27(16)10-12)24-14-5-4-13(9-15(14)31-11-19(20,21)22)17(28)23-7-8-32(2,29)30/h3-6,9-10H,7-8,11H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | BNVVYPJCTLCRFT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |