C9H14O5S — CID 118104085
(1,2-dimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-7-yl)methanol (PubChem CID 118104085) has the molecular formula C9H14O5S and a molecular weight of 234.27 g/mol. Its IUPAC name is (1,2-dimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-7-yl)methanol.
| Compound Name | (1,2-dimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-7-yl)methanol |
|---|---|
| PubChem CID | 118104085 |
| Molecular Formula | C9H14O5S |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (1,2-dimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-7-yl)methanol |
| SMILES | CC1C2OS(=O)(=O)C3CC1(C)OC23CO |
| InChI | InChI=1S/C9H14O5S/c1-5-7-9(4-10)6(15(11,12)13-7)3-8(5,2)14-9/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | SZWVUOMTKDVEGM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|