C21H24ClNO2 — CID 11810454
methyl 1-benzyl-3-[(4-chlorophenyl)methyl]piperidine-3-carboxylate (PubChem CID 11810454) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is methyl 1-benzyl-3-[(4-chlorophenyl)methyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-benzyl-3-[(4-chlorophenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 11810454 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | methyl 1-benzyl-3-[(4-chlorophenyl)methyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1(Cc2ccc(Cl)cc2)CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H24ClNO2/c1-25-20(24)21(14-17-8-10-19(22)11-9-17)12-5-13-23(16-21)15-18-6-3-2-4-7-18/h2-4,6-11H,5,12-16H2,1H3 |
| InChIKey | NRRIATDZKJSCGX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |