C35H23N5 — CID 118104643
8-(2,6-diphenyl-4-pyridinyl)-10-phenyl-3,5,8,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11,13,15-heptaene (PubChem CID 118104643) has the molecular formula C35H23N5 and a molecular weight of 513.60 g/mol. Its IUPAC name is 8-(2,6-diphenyl-4-pyridinyl)-10-phenyl-3,5,8,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11,13,15-heptaene.
| Compound Name | 8-(2,6-diphenyl-4-pyridinyl)-10-phenyl-3,5,8,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11,13,15-heptaene |
|---|---|
| PubChem CID | 118104643 |
| Molecular Formula | C35H23N5 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 8-(2,6-diphenyl-4-pyridinyl)-10-phenyl-3,5,8,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11,13,15-heptaene |
| SMILES | c1ccc(-c2cc(-n3c4cncnc4c4c5ccccc5n(-c5ccccc5)c43)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C35H23N5/c1-4-12-24(13-5-1)29-20-27(21-30(38-29)25-14-6-2-7-15-25)40-32-22-36-23-37-34(32)33-28-18-10-11-19-31(28)39(35(33)40)26-16-8-3-9-17-26/h1-23H |
| InChIKey | QMJBTMZQSYDSNE-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |