C12H7N3S — CID 118104805
8-thia-4,6,10-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11,13,15-heptaene (PubChem CID 118104805) has the molecular formula C12H7N3S and a molecular weight of 225.28 g/mol. Its IUPAC name is 8-thia-4,6,10-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11,13,15-heptaene.
| Compound Name | 8-thia-4,6,10-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11,13,15-heptaene |
|---|---|
| PubChem CID | 118104805 |
| Molecular Formula | C12H7N3S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 8-thia-4,6,10-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11,13,15-heptaene |
| SMILES | c1ccc2c(c1)[nH]c1sc3ncncc3c12 |
| InChI | InChI=1S/C12H7N3S/c1-2-4-9-7(3-1)10-8-5-13-6-14-11(8)16-12(10)15-9/h1-6,15H |
| InChIKey | NGXDGPURFWZUOM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |