C28H19N5O — CID 118104823
8-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-oxa-3,8-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaene (PubChem CID 118104823) has the molecular formula C28H19N5O and a molecular weight of 441.49 g/mol. Its IUPAC name is 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-oxa-3,8-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaene.
| Compound Name | 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-oxa-3,8-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaene |
|---|---|
| PubChem CID | 118104823 |
| Molecular Formula | C28H19N5O |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-oxa-3,8-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaene |
| SMILES | C1=Cc2c(c3c4ccccc4oc3n2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)NC1 |
| InChI | InChI=1S/C28H19N5O/c1-3-10-18(11-4-1)25-30-26(19-12-5-2-6-13-19)32-28(31-25)33-21-15-9-17-29-24(21)23-20-14-7-8-16-22(20)34-27(23)33/h1-16,29H,17H2 |
| InChIKey | HXQHXYGPUQDKCS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |