C23H26F2N4O2 — CID 118104850
5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-4-(oxolan-2-ylmethyl)pyrazolo[1,5-a]pyridine;formamide (PubChem CID 118104850) has the molecular formula C23H26F2N4O2 and a molecular weight of 428.48 g/mol. Its IUPAC name is 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-4-(oxolan-2-ylmethyl)pyrazolo[1,5-a]pyridine;formamide.
| Compound Name | 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-4-(oxolan-2-ylmethyl)pyrazolo[1,5-a]pyridine;formamide |
|---|---|
| PubChem CID | 118104850 |
| Molecular Formula | C23H26F2N4O2 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-4-(oxolan-2-ylmethyl)pyrazolo[1,5-a]pyridine;formamide |
| SMILES | Fc1ccc(F)c(C2CCCN2c2ccn3nccc3c2CC2CCCO2)c1.NC=O |
| InChI | InChI=1S/C22H23F2N3O.CH3NO/c23-15-5-6-19(24)17(13-15)20-4-1-10-26(20)21-8-11-27-22(7-9-25-27)18(21)14-16-3-2-12-28-16;2-1-3/h5-9,11,13,16,20H,1-4,10,12,14H2;1H,(H2,2,3) |
| InChIKey | DDXFTIXUZJTXIP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|