C24H28N2O6S — CID 118105018
4-(4-aminophenyl)sulfonyl-2,3,5,6-tetrakis(oxiran-2-ylmethyl)aniline (PubChem CID 118105018) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfonyl-2,3,5,6-tetrakis(oxiran-2-ylmethyl)aniline.
| Compound Name | 4-(4-aminophenyl)sulfonyl-2,3,5,6-tetrakis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 118105018 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 4-(4-aminophenyl)sulfonyl-2,3,5,6-tetrakis(oxiran-2-ylmethyl)aniline |
| SMILES | Nc1ccc(S(=O)(=O)c2c(CC3CO3)c(CC3CO3)c(N)c(CC3CO3)c2CC2CO2)cc1 |
| InChI | InChI=1S/C24H28N2O6S/c25-13-1-3-18(4-2-13)33(27,28)24-21(7-16-11-31-16)19(5-14-9-29-14)23(26)20(6-15-10-30-15)22(24)8-17-12-32-17/h1-4,14-17H,5-12,25-26H2 |
| InChIKey | YQAVLSJXRJIAGY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|