C26H32N2O6S — CID 118105039
4-[4-amino-2-methyl-3-(oxiran-2-ylmethyl)phenyl]sulfonyl-3-methyl-2,5,6-tris(oxiran-2-ylmethyl)aniline (PubChem CID 118105039) has the molecular formula C26H32N2O6S and a molecular weight of 500.62 g/mol. Its IUPAC name is 4-[4-amino-2-methyl-3-(oxiran-2-ylmethyl)phenyl]sulfonyl-3-methyl-2,5,6-tris(oxiran-2-ylmethyl)aniline.
| Compound Name | 4-[4-amino-2-methyl-3-(oxiran-2-ylmethyl)phenyl]sulfonyl-3-methyl-2,5,6-tris(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 118105039 |
| Molecular Formula | C26H32N2O6S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-[4-amino-2-methyl-3-(oxiran-2-ylmethyl)phenyl]sulfonyl-3-methyl-2,5,6-tris(oxiran-2-ylmethyl)aniline |
| SMILES | Cc1c(S(=O)(=O)c2c(C)c(CC3CO3)c(N)c(CC3CO3)c2CC2CO2)ccc(N)c1CC1CO1 |
| InChI | InChI=1S/C26H32N2O6S/c1-13-19(5-15-9-31-15)23(27)3-4-24(13)35(29,30)26-14(2)20(6-16-10-32-16)25(28)21(7-17-11-33-17)22(26)8-18-12-34-18/h3-4,15-18H,5-12,27-28H2,1-2H3 |
| InChIKey | LUNXJHNOTDFJPL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|