About potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate
potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate (PubChem CID 118105192) has the molecular formula C19H17F2KN2O2
and a molecular weight of 382.45 g/mol. Its IUPAC name is potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate.
Molecular Properties
| Compound Name | potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate |
| PubChem CID | 118105192 |
| Molecular Formula | C19H17F2KN2O2 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate |
| SMILES | Cc1cccc(C)c1Cn1nc(C)c2ccc(C(F)(F)C(=O)[O-])cc21.[K+] |
| InChI | InChI=1S/C19H18F2N2O2.K/c1-11-5-4-6-12(2)16(11)10-23-17-9-14(19(20,21)18(24)25)7-8-15(17)13(3)22-23;/h4-9H,10H2,1-3H3,(H,24,25);/q;+1/p-1 |
| InChIKey | FMWHVLVKWIKQAR-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate?
The IUPAC name of potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate (CID 118105192) is potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate.
What is the SMILES notation for potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate?
The canonical SMILES for potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate is Cc1cccc(C)c1Cn1nc(C)c2ccc(C(F)(F)C(=O)[O-])cc21.[K+].
What is the InChIKey of potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate?
The InChIKey is FMWHVLVKWIKQAR-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H18F2N2O2.K/c1-11-5-4-6-12(2)16(11)10-23-17-9-14(19(20,21)18(24)25)7-8-15(17)13(3)22-23;/h4-9H,10H2,1-3H3,(H,24,25);/q;+1/p-1.
What are the key properties of potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate?
potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate has a molecular weight of 382.45 g/mol, XLogP of -0.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-[1-[(2,6-dimethylphenyl)methyl]-3-methylindazol-6-yl]-2,2-difluoroacetate is sourced from PubChem (CID 118105192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).