About N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide
N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide (PubChem CID 11810571) has the molecular formula C18H22N2O4S
and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide |
| PubChem CID | 11810571 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide |
| SMILES | CN(CCc1ccc(NS(C)(=O)=O)cc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H22N2O4S/c1-20(12-15-5-8-17-18(11-15)24-13-23-17)10-9-14-3-6-16(7-4-14)19-25(2,21)22/h3-8,11,19H,9-10,12-13H2,1-2H3 |
| InChIKey | MRVPEVMSIPPKTF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide?
The IUPAC name of N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide (CID 11810571) is N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide?
The canonical SMILES for N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide is CN(CCc1ccc(NS(C)(=O)=O)cc1)Cc1ccc2c(c1)OCO2.
What is the InChIKey of N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide?
The InChIKey is MRVPEVMSIPPKTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O4S/c1-20(12-15-5-8-17-18(11-15)24-13-23-17)10-9-14-3-6-16(7-4-14)19-25(2,21)22/h3-8,11,19H,9-10,12-13H2,1-2H3.
What are the key properties of N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide?
N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide has a molecular weight of 362.45 g/mol, XLogP of 2.46, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]ethyl]phenyl]methanesulfonamide is sourced from PubChem (CID 11810571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).