C17H20N2O7 — CID 11810614
(5R,7S,8R,9R)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-dihydroxy-3-phenyl-6-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 11810614) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is (5R,7S,8R,9R)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-dihydroxy-3-phenyl-6-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R,7S,8R,9R)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-dihydroxy-3-phenyl-6-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 11810614 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (5R,7S,8R,9R)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-dihydroxy-3-phenyl-6-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@]3(NC(=O)N(c4ccccc4)C3=O)[C@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C17H20N2O7/c1-16(2)24-8-10(25-16)12-11(20)13(21)17(26-12)14(22)19(15(23)18-17)9-6-4-3-5-7-9/h3-7,10-13,20-21H,8H2,1-2H3,(H,18,23)/t10-,11+,12-,13-,17-/m1/s1 |
| InChIKey | FKETXKLSSVKVCJ-QMZWZUABSA-N |
| XLogP | -0.29 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|