C19H22ClF3N2O5 — CID 118106662
(3S)-3-[4-chloro-3-[[4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]phenyl]butanoic acid (PubChem CID 118106662) has the molecular formula C19H22ClF3N2O5 and a molecular weight of 450.84 g/mol. Its IUPAC name is (3S)-3-[4-chloro-3-[[4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]phenyl]butanoic acid.
| Compound Name | (3S)-3-[4-chloro-3-[[4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 118106662 |
| Molecular Formula | C19H22ClF3N2O5 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (3S)-3-[4-chloro-3-[[4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]phenyl]butanoic acid |
| SMILES | C=CCOC(=O)NC(C(=O)Nc1cc([C@@H](C)CC(=O)O)ccc1Cl)C(C)C(F)(F)F |
| InChI | InChI=1S/C19H22ClF3N2O5/c1-4-7-30-18(29)25-16(11(3)19(21,22)23)17(28)24-14-9-12(5-6-13(14)20)10(2)8-15(26)27/h4-6,9-11,16H,1,7-8H2,2-3H3,(H,24,28)(H,25,29)(H,26,27)/t10-,11?,16?/m0/s1 |
| InChIKey | AAPYQGDVDPJQLE-SGWRBKMISA-N |
| XLogP | 4.34 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|