About (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid
(6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid (PubChem CID 118106857) has the molecular formula C10H11ClN2O3
and a molecular weight of 242.66 g/mol. Its IUPAC name is (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid.
Molecular Properties
| Compound Name | (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid |
| PubChem CID | 118106857 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid |
| SMILES | CCc1c(Cl)nc2n(c1=O)[C@H](C(=O)O)CC2 |
| InChI | InChI=1S/C10H11ClN2O3/c1-2-5-8(11)12-7-4-3-6(10(15)16)13(7)9(5)14/h6H,2-4H2,1H3,(H,15,16)/t6-/m0/s1 |
| InChIKey | YUBAPOGZHSHOIH-LURJTMIESA-N |
| XLogP | 1.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid?
The IUPAC name of (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid (CID 118106857) is (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid.
What is the SMILES notation for (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid?
The canonical SMILES for (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid is CCc1c(Cl)nc2n(c1=O)[C@H](C(=O)O)CC2.
What is the InChIKey of (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid?
The InChIKey is YUBAPOGZHSHOIH-LURJTMIESA-N. The full InChI is InChI=1S/C10H11ClN2O3/c1-2-5-8(11)12-7-4-3-6(10(15)16)13(7)9(5)14/h6H,2-4H2,1H3,(H,15,16)/t6-/m0/s1.
What are the key properties of (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid?
(6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid has a molecular weight of 242.66 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2-chloro-3-ethyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 118106857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).