C23H19FN6OS — CID 118106949
(9S)-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-(6-methyl-3-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118106949) has the molecular formula C23H19FN6OS and a molecular weight of 446.51 g/mol. Its IUPAC name is (9S)-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-(6-methyl-3-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-(6-methyl-3-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118106949 |
| Molecular Formula | C23H19FN6OS |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (9S)-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-(6-methyl-3-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1ccc(-c2ccc3c(n2)N(C(=O)Nc2nc4ccc(F)cc4s2)[C@H]2CCN3C2)cn1 |
| InChI | InChI=1S/C23H19FN6OS/c1-13-2-3-14(11-25-13)17-6-7-19-21(26-17)30(16-8-9-29(19)12-16)23(31)28-22-27-18-5-4-15(24)10-20(18)32-22/h2-7,10-11,16H,8-9,12H2,1H3,(H,27,28,31)/t16-/m0/s1 |
| InChIKey | HVBVYEHGASMOPM-INIZCTEOSA-N |
| XLogP | 4.83 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |