C20H23ClF3N7O — CID 118106965
(9S)-N-pyrimidin-4-yl-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;hydrochloride (PubChem CID 118106965) has the molecular formula C20H23ClF3N7O and a molecular weight of 469.90 g/mol. Its IUPAC name is (9S)-N-pyrimidin-4-yl-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;hydrochloride.
| Compound Name | (9S)-N-pyrimidin-4-yl-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118106965 |
| Molecular Formula | C20H23ClF3N7O |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (9S)-N-pyrimidin-4-yl-5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccncn1)N1c2nc(N3CCCC(C(F)(F)F)C3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C20H22F3N7O.ClH/c21-20(22,23)13-2-1-8-29(10-13)17-4-3-15-18(27-17)30(14-6-9-28(15)11-14)19(31)26-16-5-7-24-12-25-16;/h3-5,7,12-14H,1-2,6,8-11H2,(H,24,25,26,31);1H/t13?,14-;/m0./s1 |
| InChIKey | WGNGRKAVNZMXRI-IJDFPQMLSA-N |
| XLogP | 3.70 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |