C18H17F3N6O2 — CID 118107182
(9S)-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 118107182) has the molecular formula C18H17F3N6O2 and a molecular weight of 406.37 g/mol. Its IUPAC name is (9S)-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 118107182 |
| Molecular Formula | C18H17F3N6O2 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (9S)-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C18H17F3N6O2/c19-18(20,21)10-23-16(28)12-4-5-13-15(24-12)27(11-6-8-26(13)9-11)17(29)25-14-3-1-2-7-22-14/h1-5,7,11H,6,8-10H2,(H,23,28)(H,22,25,29)/t11-/m0/s1 |
| InChIKey | SDGVBGQQQONFBT-NSHDSACASA-N |
| XLogP | 2.40 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |