C23H27F3N4O2 — CID 118107237
3-methoxy-N-pentyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118107237) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 3-methoxy-N-pentyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 3-methoxy-N-pentyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118107237 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-methoxy-N-pentyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CCCCCNC(=O)N1c2nc(-c3cccc(C(F)(F)F)c3)cc(OC)c2N2CCC1C2 |
| InChI | InChI=1S/C23H27F3N4O2/c1-3-4-5-10-27-22(31)30-17-9-11-29(14-17)20-19(32-2)13-18(28-21(20)30)15-7-6-8-16(12-15)23(24,25)26/h6-8,12-13,17H,3-5,9-11,14H2,1-2H3,(H,27,31) |
| InChIKey | RQAAFUZAJDVECL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|