C19H19F3N6O3 — CID 118107272
(9S)-8-N-pyridin-2-yl-5-N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 118107272) has the molecular formula C19H19F3N6O3 and a molecular weight of 436.39 g/mol. Its IUPAC name is (9S)-8-N-pyridin-2-yl-5-N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-pyridin-2-yl-5-N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 118107272 |
| Molecular Formula | C19H19F3N6O3 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (9S)-8-N-pyridin-2-yl-5-N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NC(CO)C(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C19H19F3N6O3/c20-19(21,22)14(10-29)25-17(30)12-4-5-13-16(24-12)28(11-6-8-27(13)9-11)18(31)26-15-3-1-2-7-23-15/h1-5,7,11,14,29H,6,8-10H2,(H,25,30)(H,23,26,31)/t11-,14?/m0/s1 |
| InChIKey | JNIUCRQWCYWETN-ZSOXZCCMSA-N |
| XLogP | 1.76 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |