C21H18F3N7O — CID 118107299
(9S)-N-pyrimidin-5-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118107299) has the molecular formula C21H18F3N7O and a molecular weight of 441.42 g/mol. Its IUPAC name is (9S)-N-pyrimidin-5-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-pyrimidin-5-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118107299 |
| Molecular Formula | C21H18F3N7O |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (9S)-N-pyrimidin-5-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cncnc1)N1c2nc(-c3ccnc(C(F)(F)F)c3)ccc2N2CCC[C@H]1C2 |
| InChI | InChI=1S/C21H18F3N7O/c22-21(23,24)18-8-13(5-6-27-18)16-3-4-17-19(29-16)31(15-2-1-7-30(17)11-15)20(32)28-14-9-25-12-26-10-14/h3-6,8-10,12,15H,1-2,7,11H2,(H,28,32)/t15-/m0/s1 |
| InChIKey | YVNRSPYCSRNOJA-HNNXBMFYSA-N |
| XLogP | 3.97 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |