C35H29F3N6O4 — CID 118107329
benzyl-[[5-[3-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]phenyl]-1,3-oxazol-2-yl]methyl]carbamic acid (PubChem CID 118107329) has the molecular formula C35H29F3N6O4 and a molecular weight of 654.65 g/mol. Its IUPAC name is benzyl-[[5-[3-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]phenyl]-1,3-oxazol-2-yl]methyl]carbamic acid.
| Compound Name | benzyl-[[5-[3-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]phenyl]-1,3-oxazol-2-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 118107329 |
| Molecular Formula | C35H29F3N6O4 |
| Molecular Weight | 654.65 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | benzyl-[[5-[3-[[(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]phenyl]-1,3-oxazol-2-yl]methyl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)Cc1ncc(-c2cccc(NC(=O)N3c4nc(-c5cccc(C(F)(F)F)c5)ccc4N4CC[C@H]3C4)c2)o1 |
| InChI | InChI=1S/C35H29F3N6O4/c36-35(37,38)25-10-4-8-23(16-25)28-12-13-29-32(41-28)44(27-14-15-42(29)20-27)33(45)40-26-11-5-9-24(17-26)30-18-39-31(48-30)21-43(34(46)47)19-22-6-2-1-3-7-22/h1-13,16-18,27H,14-15,19-21H2,(H,40,45)(H,46,47)/t27-/m0/s1 |
| InChIKey | FMULNGZLEHFHPU-MHZLTWQESA-N |
| XLogP | 7.73 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.65 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |