C20H21F3N6O3 — CID 118107339
(9S)-8-N-pyridin-2-yl-5-N-(1,1,1-trifluoro-3-methoxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 118107339) has the molecular formula C20H21F3N6O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is (9S)-8-N-pyridin-2-yl-5-N-(1,1,1-trifluoro-3-methoxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-pyridin-2-yl-5-N-(1,1,1-trifluoro-3-methoxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 118107339 |
| Molecular Formula | C20H21F3N6O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (9S)-8-N-pyridin-2-yl-5-N-(1,1,1-trifluoro-3-methoxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | COCC(NC(=O)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C20H21F3N6O3/c1-32-11-15(20(21,22)23)26-18(30)13-5-6-14-17(25-13)29(12-7-9-28(14)10-12)19(31)27-16-4-2-3-8-24-16/h2-6,8,12,15H,7,9-11H2,1H3,(H,26,30)(H,24,27,31)/t12-,15?/m0/s1 |
| InChIKey | HNODSRSRBLZSAV-SFVWDYPZSA-N |
| XLogP | 2.41 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |