About 3-iodo-9-phenylcarbazole
3-iodo-9-phenylcarbazole (PubChem CID 11810740) has the molecular formula C18H12IN
and a molecular weight of 369.21 g/mol. Its IUPAC name is 3-iodo-9-phenylcarbazole.
Molecular Properties
| Compound Name | 3-iodo-9-phenylcarbazole |
| PubChem CID | 11810740 |
| Molecular Formula | C18H12IN |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 3-iodo-9-phenylcarbazole |
| SMILES | Ic1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C18H12IN/c19-13-10-11-18-16(12-13)15-8-4-5-9-17(15)20(18)14-6-2-1-3-7-14/h1-12H |
| InChIKey | PJUAIXDOXUXBDR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-9-phenylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-9-phenylcarbazole?
The IUPAC name of 3-iodo-9-phenylcarbazole (CID 11810740) is 3-iodo-9-phenylcarbazole.
What is the SMILES notation for 3-iodo-9-phenylcarbazole?
The canonical SMILES for 3-iodo-9-phenylcarbazole is Ic1ccc2c(c1)c1ccccc1n2-c1ccccc1.
What is the InChIKey of 3-iodo-9-phenylcarbazole?
The InChIKey is PJUAIXDOXUXBDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12IN/c19-13-10-11-18-16(12-13)15-8-4-5-9-17(15)20(18)14-6-2-1-3-7-14/h1-12H.
What are the key properties of 3-iodo-9-phenylcarbazole?
3-iodo-9-phenylcarbazole has a molecular weight of 369.21 g/mol, XLogP of 5.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-9-phenylcarbazole is sourced from PubChem (CID 11810740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).