C25H38O2 — CID 11810786
2-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-5,5-dimethyl-1,3-dioxane (PubChem CID 11810786) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 11810786 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-5,5-dimethyl-1,3-dioxane |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C2OCC(C)(C)CO2)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H38O2/c1-19(13-14-22-21(3)12-9-15-25(22,6)7)10-8-11-20(2)16-23-26-17-24(4,5)18-27-23/h8,10-11,13-14,16,23H,9,12,15,17-18H2,1-7H3/b11-8+,14-13+,19-10+,20-16+ |
| InChIKey | AJCHKCKBWGFEOO-NUAALOKZSA-N |
| XLogP | 6.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|