About [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine
[4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine (PubChem CID 118108087) has the molecular formula C15H16Cl3N5
and a molecular weight of 372.69 g/mol. Its IUPAC name is [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine.
Molecular Properties
| Compound Name | [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine |
| PubChem CID | 118108087 |
| Molecular Formula | C15H16Cl3N5 |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine |
| SMILES | NNc1nncc(N2CCC(c3cc(Cl)cc(Cl)c3)CC2)c1Cl |
| InChI | InChI=1S/C15H16Cl3N5/c16-11-5-10(6-12(17)7-11)9-1-3-23(4-2-9)13-8-20-22-15(21-19)14(13)18/h5-9H,1-4,19H2,(H,21,22) |
| InChIKey | UZODTHJAAWKHCF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine?
The IUPAC name of [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine (CID 118108087) is [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine.
What is the SMILES notation for [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine?
The canonical SMILES for [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine is NNc1nncc(N2CCC(c3cc(Cl)cc(Cl)c3)CC2)c1Cl.
What is the InChIKey of [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine?
The InChIKey is UZODTHJAAWKHCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl3N5/c16-11-5-10(6-12(17)7-11)9-1-3-23(4-2-9)13-8-20-22-15(21-19)14(13)18/h5-9H,1-4,19H2,(H,21,22).
What are the key properties of [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine?
[4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine has a molecular weight of 372.69 g/mol, XLogP of 4.11, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-5-[4-(3,5-dichlorophenyl)piperidin-1-yl]pyridazin-3-yl]hydrazine is sourced from PubChem (CID 118108087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).