C18H19ClF3N7O2 — CID 118108117
8-chloro-7-[4-(4,6-dimethoxypyrimidin-2-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 118108117) has the molecular formula C18H19ClF3N7O2 and a molecular weight of 457.84 g/mol. Its IUPAC name is 8-chloro-7-[4-(4,6-dimethoxypyrimidin-2-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 8-chloro-7-[4-(4,6-dimethoxypyrimidin-2-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 118108117 |
| Molecular Formula | C18H19ClF3N7O2 |
| Molecular Weight | 457.84 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 8-chloro-7-[4-(4,6-dimethoxypyrimidin-2-yl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | COc1cc(OC)nc(C2CCN(c3cnn4c(CC(F)(F)F)nnc4c3Cl)CC2)n1 |
| InChI | InChI=1S/C18H19ClF3N7O2/c1-30-13-7-14(31-2)25-16(24-13)10-3-5-28(6-4-10)11-9-23-29-12(8-18(20,21)22)26-27-17(29)15(11)19/h7,9-10H,3-6,8H2,1-2H3 |
| InChIKey | GSUNSDDXEUDFKY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |