C18H13Cl3N2O2 — CID 1181085
3-chloro-1-(2,4-dichlorophenyl)-4-(3,4-dimethylanilino)pyrrole-2,5-dione (PubChem CID 1181085) has the molecular formula C18H13Cl3N2O2 and a molecular weight of 395.67 g/mol. Its IUPAC name is 3-chloro-1-(2,4-dichlorophenyl)-4-(3,4-dimethylanilino)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(2,4-dichlorophenyl)-4-(3,4-dimethylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1181085 |
| Molecular Formula | C18H13Cl3N2O2 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 3-chloro-1-(2,4-dichlorophenyl)-4-(3,4-dimethylanilino)pyrrole-2,5-dione |
| SMILES | Cc1ccc(NC2=C(Cl)C(=O)N(c3ccc(Cl)cc3Cl)C2=O)cc1C |
| InChI | InChI=1S/C18H13Cl3N2O2/c1-9-3-5-12(7-10(9)2)22-16-15(21)17(24)23(18(16)25)14-6-4-11(19)8-13(14)20/h3-8,22H,1-2H3 |
| InChIKey | ZOXLBARERFTONT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|