C25H26OS8 — CID 118108695
bis(2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl)methanone (PubChem CID 118108695) has the molecular formula C25H26OS8 and a molecular weight of 599.02 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl)methanone.
| Compound Name | bis(2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl)methanone |
|---|---|
| PubChem CID | 118108695 |
| Molecular Formula | C25H26OS8 |
| Molecular Weight | 599.02 g/mol |
| Exact Mass | 597.97 |
| IUPAC Name | bis(2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl)methanone |
| SMILES | CC1(C)Sc2cc3c(c(C(=O)c4c5c(cc6c4SC(C)(C)S6)SC(C)(C)S5)c2S1)SC(C)(C)S3 |
| InChI | InChI=1S/C25H26OS8/c1-22(2)27-11-9-12-19(32-23(3,4)28-12)15(18(11)31-22)17(26)16-20-13(29-24(5,6)33-20)10-14-21(16)34-25(7,8)30-14/h9-10H,1-8H3 |
| InChIKey | JRFJLPOGHUVQIZ-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.02 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |