C28H33NO7S — CID 118108757
[(2R,3S,4R,5E)-5-methoxyimino-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate (PubChem CID 118108757) has the molecular formula C28H33NO7S and a molecular weight of 527.64 g/mol. Its IUPAC name is [(2R,3S,4R,5E)-5-methoxyimino-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate.
| Compound Name | [(2R,3S,4R,5E)-5-methoxyimino-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 118108757 |
| Molecular Formula | C28H33NO7S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | [(2R,3S,4R,5E)-5-methoxyimino-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
| SMILES | CO/N=C/[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C28H33NO7S/c1-32-29-18-26(34-20-24-14-8-4-9-15-24)28(35-21-25-16-10-5-11-17-25)27(36-37(2,30)31)22-33-19-23-12-6-3-7-13-23/h3-18,26-28H,19-22H2,1-2H3/b29-18+/t26-,27-,28+/m1/s1 |
| InChIKey | BNOUHPPEPDXFQE-SOJNNWKWSA-N |
| XLogP | 4.35 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|