C8H12FNO8 — CID 118108815
[(2R,3R,4R,5E)-1-carboxyoxy-4-fluoro-2-hydroxy-5-methoxyiminopentan-3-yl] hydrogen carbonate (PubChem CID 118108815) has the molecular formula C8H12FNO8 and a molecular weight of 269.18 g/mol. Its IUPAC name is [(2R,3R,4R,5E)-1-carboxyoxy-4-fluoro-2-hydroxy-5-methoxyiminopentan-3-yl] hydrogen carbonate.
| Compound Name | [(2R,3R,4R,5E)-1-carboxyoxy-4-fluoro-2-hydroxy-5-methoxyiminopentan-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118108815 |
| Molecular Formula | C8H12FNO8 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | [(2R,3R,4R,5E)-1-carboxyoxy-4-fluoro-2-hydroxy-5-methoxyiminopentan-3-yl] hydrogen carbonate |
| SMILES | CO/N=C/[C@@H](F)[C@H](OC(=O)O)[C@H](O)COC(=O)O |
| InChI | InChI=1S/C8H12FNO8/c1-16-10-2-4(9)6(18-8(14)15)5(11)3-17-7(12)13/h2,4-6,11H,3H2,1H3,(H,12,13)(H,14,15)/b10-2+/t4-,5-,6+/m1/s1 |
| InChIKey | HUQPIBLJONHUSS-HXJYWFAOSA-N |
| XLogP | 0.08 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|