C27H30O7S — CID 118108872
[(2R,3S,4S)-5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate (PubChem CID 118108872) has the molecular formula C27H30O7S and a molecular weight of 498.60 g/mol. Its IUPAC name is [(2R,3S,4S)-5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate.
| Compound Name | [(2R,3S,4S)-5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 118108872 |
| Molecular Formula | C27H30O7S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [(2R,3S,4S)-5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H30O7S/c1-35(29,30)34-26(21-31-18-22-11-5-2-6-12-22)27(33-20-24-15-9-4-10-16-24)25(17-28)32-19-23-13-7-3-8-14-23/h2-17,25-27H,18-21H2,1H3/t25-,26-,27+/m1/s1 |
| InChIKey | UAFRRAZKMJHVQZ-PFBJBMPXSA-N |
| XLogP | 3.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|