About [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate
[5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate (PubChem CID 118108874) has the molecular formula C27H30O7S
and a molecular weight of 498.60 g/mol. Its IUPAC name is [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate.
Molecular Properties
| Compound Name | [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
| PubChem CID | 118108874 |
| Molecular Formula | C27H30O7S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(COCc1ccccc1)C(OCc1ccccc1)C(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H30O7S/c1-35(29,30)34-26(21-31-18-22-11-5-2-6-12-22)27(33-20-24-15-9-4-10-16-24)25(17-28)32-19-23-13-7-3-8-14-23/h2-17,25-27H,18-21H2,1H3 |
| InChIKey | UAFRRAZKMJHVQZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate?
The IUPAC name of [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate (CID 118108874) is [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate.
What is the SMILES notation for [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate?
The canonical SMILES for [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate is CS(=O)(=O)OC(COCc1ccccc1)C(OCc1ccccc1)C(C=O)OCc1ccccc1.
What is the InChIKey of [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate?
The InChIKey is UAFRRAZKMJHVQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30O7S/c1-35(29,30)34-26(21-31-18-22-11-5-2-6-12-22)27(33-20-24-15-9-4-10-16-24)25(17-28)32-19-23-13-7-3-8-14-23/h2-17,25-27H,18-21H2,1H3.
What are the key properties of [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate?
[5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate has a molecular weight of 498.60 g/mol, XLogP of 3.92, 15 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-oxo-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate is sourced from PubChem (CID 118108874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).