C18H19F2N5O2S2 — CID 118109136
3-cyano-4-[[(8R)-6,6-difluoro-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118109136) has the molecular formula C18H19F2N5O2S2 and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-cyano-4-[[(8R)-6,6-difluoro-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-cyano-4-[[(8R)-6,6-difluoro-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109136 |
| Molecular Formula | C18H19F2N5O2S2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 3-cyano-4-[[(8R)-6,6-difluoro-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methylamino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | N#Cc1cc(S(=O)(=O)Nc2nccs2)ccc1NC[C@]12CCCN1CC(F)(F)C2 |
| InChI | InChI=1S/C18H19F2N5O2S2/c19-18(20)10-17(4-1-6-25(17)12-18)11-23-15-3-2-14(8-13(15)9-21)29(26,27)24-16-22-5-7-28-16/h2-3,5,7-8,23H,1,4,6,10-12H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | SWUKAHWNFKTATP-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |