C18H21ClFN5O2S — CID 118109234
5-chloro-2-fluoro-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 118109234) has the molecular formula C18H21ClFN5O2S and a molecular weight of 425.92 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 118109234 |
| Molecular Formula | C18H21ClFN5O2S |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 5-chloro-2-fluoro-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccncn1)c1cc(Cl)c(NCC23CCCN2CCC3)cc1F |
| InChI | InChI=1S/C18H21ClFN5O2S/c19-13-9-16(28(26,27)24-17-3-6-21-12-23-17)14(20)10-15(13)22-11-18-4-1-7-25(18)8-2-5-18/h3,6,9-10,12,22H,1-2,4-5,7-8,11H2,(H,21,23,24) |
| InChIKey | IATOIMGOUCQDRU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |