C18H19F5N4O2S2 — CID 118109287
4-[[(1S)-6-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methylamino]-N-(5-fluoro-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 118109287) has the molecular formula C18H19F5N4O2S2 and a molecular weight of 482.50 g/mol. Its IUPAC name is 4-[[(1S)-6-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methylamino]-N-(5-fluoro-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[[(1S)-6-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methylamino]-N-(5-fluoro-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109287 |
| Molecular Formula | C18H19F5N4O2S2 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 4-[[(1S)-6-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methylamino]-N-(5-fluoro-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncc(F)s1)c1ccc(NC[C@@H]2CCN3CC(F)CC23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F5N4O2S2/c19-11-5-15-10(3-4-27(15)9-11)7-24-14-2-1-12(6-13(14)18(21,22)23)31(28,29)26-17-25-8-16(20)30-17/h1-2,6,8,10-11,15,24H,3-5,7,9H2,(H,25,26)/t10-,11?,15?/m0/s1 |
| InChIKey | CLMBAYLMBRZEFB-NLTNOIMHSA-N |
| XLogP | 3.95 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |