C18H21ClF2N4O2S2 — CID 118109304
5-chloro-2-fluoro-N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide (PubChem CID 118109304) has the molecular formula C18H21ClF2N4O2S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 118109304 |
| Molecular Formula | C18H21ClF2N4O2S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 5-chloro-2-fluoro-N-(5-fluoro-4-methyl-1,3-thiazol-2-yl)-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2cc(Cl)c(NCC34CCCN3CCC4)cc2F)sc1F |
| InChI | InChI=1S/C18H21ClF2N4O2S2/c1-11-16(21)28-17(23-11)24-29(26,27)15-8-12(19)14(9-13(15)20)22-10-18-4-2-6-25(18)7-3-5-18/h8-9,22H,2-7,10H2,1H3,(H,23,24) |
| InChIKey | NRDVNSLOKZCIOU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |