C17H19Cl2FN4O2S2 — CID 118109371
5-chloro-N-(5-chloro-1,3-thiazol-2-yl)-2-fluoro-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide (PubChem CID 118109371) has the molecular formula C17H19Cl2FN4O2S2 and a molecular weight of 465.40 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-1,3-thiazol-2-yl)-2-fluoro-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide.
| Compound Name | 5-chloro-N-(5-chloro-1,3-thiazol-2-yl)-2-fluoro-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 118109371 |
| Molecular Formula | C17H19Cl2FN4O2S2 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 5-chloro-N-(5-chloro-1,3-thiazol-2-yl)-2-fluoro-4-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethylamino)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncc(Cl)s1)c1cc(Cl)c(NCC23CCCN2CCC3)cc1F |
| InChI | InChI=1S/C17H19Cl2FN4O2S2/c18-11-7-14(28(25,26)23-16-21-9-15(19)27-16)12(20)8-13(11)22-10-17-3-1-5-24(17)6-2-4-17/h7-9,22H,1-6,10H2,(H,21,23) |
| InChIKey | XKBRSTVJHZNPSS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |