C18H22N2O9 — CID 118109484
(2S,3R)-2,3-diacetyloxy-4-oxo-4-[2-(phenylmethoxycarbonylamino)ethylamino]butanoic acid (PubChem CID 118109484) has the molecular formula C18H22N2O9 and a molecular weight of 410.38 g/mol. Its IUPAC name is (2S,3R)-2,3-diacetyloxy-4-oxo-4-[2-(phenylmethoxycarbonylamino)ethylamino]butanoic acid.
| Compound Name | (2S,3R)-2,3-diacetyloxy-4-oxo-4-[2-(phenylmethoxycarbonylamino)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 118109484 |
| Molecular Formula | C18H22N2O9 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (2S,3R)-2,3-diacetyloxy-4-oxo-4-[2-(phenylmethoxycarbonylamino)ethylamino]butanoic acid |
| SMILES | CC(=O)O[C@H](C(=O)O)[C@@H](OC(C)=O)C(=O)NCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H22N2O9/c1-11(21)28-14(15(17(24)25)29-12(2)22)16(23)19-8-9-20-18(26)27-10-13-6-4-3-5-7-13/h3-7,14-15H,8-10H2,1-2H3,(H,19,23)(H,20,26)(H,24,25)/t14-,15+/m1/s1 |
| InChIKey | LIMVCMVRWRMJIE-CABCVRRESA-N |
| XLogP | -0.02 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|