C20H24ClFN2O3 — CID 118109731
ethyl 2-fluoro-4-[5-(piperidin-4-ylmethoxy)-2-pyridinyl]benzoate;hydrochloride (PubChem CID 118109731) has the molecular formula C20H24ClFN2O3 and a molecular weight of 394.87 g/mol. Its IUPAC name is ethyl 2-fluoro-4-[5-(piperidin-4-ylmethoxy)-2-pyridinyl]benzoate;hydrochloride.
| Compound Name | ethyl 2-fluoro-4-[5-(piperidin-4-ylmethoxy)-2-pyridinyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 118109731 |
| Molecular Formula | C20H24ClFN2O3 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | ethyl 2-fluoro-4-[5-(piperidin-4-ylmethoxy)-2-pyridinyl]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCC3CCNCC3)cn2)cc1F.Cl |
| InChI | InChI=1S/C20H23FN2O3.ClH/c1-2-25-20(24)17-5-3-15(11-18(17)21)19-6-4-16(12-23-19)26-13-14-7-9-22-10-8-14;/h3-6,11-12,14,22H,2,7-10,13H2,1H3;1H |
| InChIKey | HAYBECMUUGORNT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |