C27H29F6N3O3 — CID 118109780
(2S)-4-[2-fluoro-3-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-6-phenylbenzoyl]pyrrolidine-2-carboxamide (PubChem CID 118109780) has the molecular formula C27H29F6N3O3 and a molecular weight of 557.54 g/mol. Its IUPAC name is (2S)-4-[2-fluoro-3-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-6-phenylbenzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-[2-fluoro-3-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-6-phenylbenzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118109780 |
| Molecular Formula | C27H29F6N3O3 |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | (2S)-4-[2-fluoro-3-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-6-phenylbenzoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CC(C(=O)c2c(-c3ccccc3)ccc(OCC3CCN(CC(F)(F)C(F)(F)F)CC3)c2F)CN1 |
| InChI | InChI=1S/C27H29F6N3O3/c28-23-21(39-14-16-8-10-36(11-9-16)15-26(29,30)27(31,32)33)7-6-19(17-4-2-1-3-5-17)22(23)24(37)18-12-20(25(34)38)35-13-18/h1-7,16,18,20,35H,8-15H2,(H2,34,38)/t18?,20-/m0/s1 |
| InChIKey | LCVKKYDVRYIBSV-IJHRGXPZSA-N |
| XLogP | 4.43 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|